CAS:830-96-6 | 3-Indolepropionic acid
Synonyms:
3-Indolepropionic acid 97%;3-Indolepropionic acid 2012060514594073499.gif;3-Indolebutyric Acid/IPA;2-HYDROXYPROPANE;2-PPROPANOL;3-(1H-INDOL-3-YL)PROPANOIC ACID;3-(1H-INDOL-3-YL)-PROPIONIC ACID;3-(3-INDOLYL)PROPANOIC ACID
Canonical SMILES: C1=CC=C2C(=C1)C(=CN2)CCC(=O)O
HS Code: 29339990
Density:0.960 g/mL at20 °C
Boiling Point:82 °C(lit.)
Refractive Index:n20/D1.377(lit.)
Flash Point: 53 °F
Melting Point: 134-135 °C(lit.)
Storage: ?20°C
PKA: 4.77±0.10(Predicted)
Appearance: crystalline
Hazard Codes: Xi
Risk Statements: 11-36-67-36/37/38-22-10
Safety Statements: 7-16-24/25-26-36/37-37/39-22
Transport: UN 1987 3/PG 3
WGK Germany: 3
Write your message here and send it to us