CAS:204841-19-0 |3-Acetylphenylboronic acid
Synonyms:
3-ACETYLPHENYLBORONIC ACID, 97%+;3-Acetylphenylboronic Acid (contains varying amounts of Anhydride);3-Acetylphenylboronic acid,96%;-Boronoacetophenone;3-Acetylphenylboronic acid ,98%;3-Acetylphenylboroni;3-Acetylphenylboronic acid, May contain varying amounts of anhydride, 97%;3-Acetylphenylboronic acid, 96% 10GR
Canonical SMILES: B(C1=CC(=CC=C1)C(=O)C)(O)O
HS Code: 29310095
Density:1.19±0.1g/cm3(Predicted)
Boiling Point:364.0±44.0°C(Predicted)
Melting Point: 204-208 °C(lit.)
Storage: 0-6°C
PKA: 7.74±0.10(Predicted)
Appearance: CrystallinePowder
Hazard Codes: Xi
Risk Statements: 36/37/38
Safety Statements: 26-36-37/39
WGK Germany: 3
HazardClass: IRRITANT
Write your message here and send it to us