CAS:85-52-9 | 2-Benzoylbenzoic acid
Synonyms:
OTAVA-BB BB7020401721;OBBA;O-BENZOYLBENZOIC ACID;ORTHO-BENZOYL BENZOIC ACID;2-Benzoquinonecarboxylic acid;2-benzoquinonecarboxylicacid;2-benzoyl-benzoicaci;Benzoic acid, o-benzoyl-
Canonical SMILES: C1=CC=C(C=C1)C(=O)C2=CC=CC=C2C(=O)O
HS Code: 29183000
Density:1.2022(roughestimate)
Boiling Point:257-265 °C(lit.)
Refractive Index:1.5767(estimate)
Flash Point: 257°C
Melting Point: 126-129 °C(lit.)
Storage: Storebelow+30°C.
PKA: pK1:3.54(25°C)
Appearance: CrystallinePowder
Hazard Codes: Xi
Risk Statements: 36/37/38
Safety Statements: 26-36-37/39
WGK Germany: 2
Write your message here and send it to us