Ethyl gallate
Synonyms:
N-ETHYLGALLATE;Ethyl gallate,
Gallic acid ethyl ester;3,4,5-Trihydroxybenzoic acid ethyl;Gallic acid ethyl;Gallic acid ethyl ester,99%;Ethyl Gallate [for Determination of Total Polyphenol Content];Ethyl gallate, extra pure;Gallic acid ethyl ester, 99% 100GR
Canonical SMILES: CCOC(=O)C1=CC(=C(C(=C1)O)O)O
HS Code: 29182900
Density:1.2539(roughestimate)
Boiling Point:255.48°C(roughestimate)
Refractive Index:1.4570(estimate)
Melting Point: 149-153 °C
Storage: Storebelow+30°C.
PKA: 8.04±0.23(Predicted)
Appearance: FinePowder
Safety Statements: 24/25
WGK Germany: 2
Write your message here and send it to us